CAS 1216658-90-0 appears in our catalog under these names: 1-(4-Fluorophenyl)cyclobutan-1-amine hydrochloride, 96%, 1-(4-Fluorophenyl)cyclobutan-1-amine hydrochloride, 98%, 1–(4–fluorophenyl)cyclobutan–1–amine hydrochloride, 1-(4-Fluorophenyl)cyclobutan-1-amine HCl, 1-(4-fluorophenyl)cyclobutan-1-amine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 2,5g.
1-(4-fluorophenyl)cyclobutan-1-amine;hydrochloride (CAS 1216658-90-0) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: 1-(4-fluorophenyl)cyclobutan-1-amine;hydrochloride. InChIKey: UHGWAVIHBAZSMM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | 1-(4-fluorophenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | UHGWAVIHBAZSMM-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)F)N.Cl |
Computed by PubChem (NCBI)