CAS 1217002-29-3 is the registry number for Alpha-Phenyl-Alpha-(2-pyridyl)acetonitrile-d4. Offered by: TRC. Available pack sizes: 25mg, 5mg.
2-phenyl-2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetonitrile (CAS 1217002-29-3) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 198.26 g/mol. IUPAC name: 2-phenyl-2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetonitrile. InChIKey: CAXNYFPECZCGFK-DOGSKSIHSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 2-phenyl-2-(3,4,5,6-tetradeuterio-2-pyridinyl)acetonitrile |
| InChIKey | CAXNYFPECZCGFK-DOGSKSIHSA-N |
| SMILES | [2H]C1=C(C(=NC(=C1[2H])C(C#N)C2=CC=CC=C2)[2H])[2H] |
Computed by PubChem (NCBI)