CAS 5005-36-7 appears in our catalog under these names: Alpha-Phenyl-Alpha-(2-pyridyl)acetonitrile, (RS)-Phenyl(pyridin-2-yl)acetonitrile (Pyronitrile), α–Phenyl–α–(2–pyridyl)acetonitrile, 2-Phenyl-2-(2-pyridyl)acetonitrile, >98.0%(GC), 2-Phenyl-2-(2-pyridyl)acetonitrile 97%. Offered by: TRC, Mikromol, GLPBio, TCI, Ambeed. Available pack sizes: 50mg, 4x25mg, 25mg, 100mg, 10mM (in 1ml dmso), 500mg, 1g, 5g.
2-phenyl-2-pyridin-2-ylacetonitrile (CAS 5005-36-7) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-phenyl-2-pyridin-2-ylacetonitrile. InChIKey: CAXNYFPECZCGFK-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-phenyl-2-pyridin-2-ylacetonitrile |
| InChIKey | CAXNYFPECZCGFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C#N)C2=CC=CC=N2 |
Computed by PubChem (NCBI)