Products 1217007-65-2
CAS 1217007-65-2 appears in our catalog under these names: 2-Amino-N-(4-chlorobenzyl)acetamide hydrochloride, 98%, 2-amino-N-[(4-chlorophenyl)methyl]acetamide hydrochloride, 98%. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-amino-N-[(4-chlorophenyl)methyl]acetamide;hydrochloride (CAS 1217007-65-2) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: 2-amino-N-[(4-chlorophenyl)methyl]acetamide;hydrochloride. InChIKey: INCOAADHYSIRKY-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 2-amino-N-[(4-chlorophenyl)methyl]acetamide;hydrochloride |
| InChIKey | INCOAADHYSIRKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC(=O)CN)Cl.Cl |
Computed by PubChem (NCBI)