CAS 1217439-96-7 appears in our catalog under these names: Entacapone Impurity 5, (2E)-2-Cyano-3-(3,4-dihydroxyphenyl)-N,N-diethyl-2-propenamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
(E)-2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide (CAS 1217439-96-7) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide. InChIKey: IACDFFVLQMLTIW-YRNVUSSQSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | (E)-2-cyano-3-(3,4-dihydroxyphenyl)-N,N-diethylprop-2-enamide |
| InChIKey | IACDFFVLQMLTIW-YRNVUSSQSA-N |
| SMILES | CCN(CC)C(=O)/C(=C/C1=CC(=C(C=C1)O)O)/C#N |
Computed by PubChem (NCBI)