Products 1217598-31-6

CAS 1217598-31-6 is the registry number for 1-Benzyl 2-methyl (2R,4R)-4-aminopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-benzyl 2-O-methyl (2R,4R)-4-aminopyrrolidine-1,2-dicarboxylate (CAS 1217598-31-6) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2R,4R)-4-aminopyrrolidine-1,2-dicarboxylate. InChIKey: DMYAHNRIJNKMAH-VXGBXAGGSA-N.

Identity
Molecular formulaC14H18N2O4
Molecular weight278.30 g/mol
IUPAC name1-O-benzyl 2-O-methyl (2R,4R)-4-aminopyrrolidine-1,2-dicarboxylate
InChIKeyDMYAHNRIJNKMAH-VXGBXAGGSA-N
SMILESCOC(=O)[C@H]1C[C@H](CN1C(=O)OCC2=CC=CC=C2)N

Computed by PubChem (NCBI)