CAS 739360-84-0 is the registry number for 1-Benzyl 2-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate (CAS 739360-84-0) is a chemical compound with the molecular formula C14H18N2O4 and a molecular weight of 278.30 g/mol. IUPAC name: 1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate. InChIKey: DMYAHNRIJNKMAH-NWDGAFQWSA-N.
| Molecular formula | C14H18N2O4 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | 1-O-benzyl 2-O-methyl (2R,4S)-4-aminopyrrolidine-1,2-dicarboxylate |
| InChIKey | DMYAHNRIJNKMAH-NWDGAFQWSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1C(=O)OCC2=CC=CC=C2)N |
Computed by PubChem (NCBI)