CAS 1217611-00-1 appears in our catalog under these names: (2R,4S)-4-(((Benzyloxy)carbonyl)amino)pyrrolidine-2-carboxylic acid, 95%, rel–(2R,4S)–4–(((benzyloxy)carbonyl)amino)pyrrolidine–2–carboxylic acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
(2R,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid (CAS 1217611-00-1) is a chemical compound with the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. IUPAC name: (2R,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid. InChIKey: VCZIKOUKWSDDIU-WDEREUQCSA-N.
| Molecular formula | C13H16N2O4 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | (2R,4S)-4-(phenylmethoxycarbonylamino)pyrrolidine-2-carboxylic acid |
| InChIKey | VCZIKOUKWSDDIU-WDEREUQCSA-N |
| SMILES | C1[C@@H](CN[C@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)