Products 1217625-88-1
CAS 1217625-88-1 is the registry number for Florfenicol amine-d3-1. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(1S,2R)-2-amino-2,3,3-trideuterio-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol (CAS 1217625-88-1) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 250.31 g/mol. IUPAC name: (1S,2R)-2-amino-2,3,3-trideuterio-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol. InChIKey: XLSYLQDVLAXIKK-QVCCWKKGSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 250.31 g/mol |
| IUPAC name | (1S,2R)-2-amino-2,3,3-trideuterio-3-fluoro-1-(4-methylsulfonylphenyl)propan-1-ol |
| InChIKey | XLSYLQDVLAXIKK-QVCCWKKGSA-N |
| SMILES | [2H][C@@]([C@H](C1=CC=C(C=C1)S(=O)(=O)C)O)(C([2H])([2H])F)N |
Computed by PubChem (NCBI)