CAS 1799439-05-6 is the registry number for Trans-2-fluorocyclopropanamine 4-methylbenzenesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-methylbenzenesulfonic acid;trans-(1R,2R)-2-fluorocyclopropan-1-amine (CAS 1799439-05-6) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;trans-(1R,2R)-2-fluorocyclopropan-1-amine. InChIKey: XUWZMHVPMZXIRU-GEHKUQKJSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;trans-(1R,2R)-2-fluorocyclopropan-1-amine |
| InChIKey | XUWZMHVPMZXIRU-GEHKUQKJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1[C@H]([C@@H]1F)N |
Computed by PubChem (NCBI)