CAS 185225-84-7 appears in our catalog under these names: Sitafloxacin Impurity 51, (1S,2R)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 97%, (1S,2R)-2-Fluorocyclopropanamine 4-Methylbenzenesulfonate, 95%, 95%. Offered by: Chemat Brand, AmBeed, Chemat. Available pack sizes: on request, 10g, 5g, 100mg, 250mg, 500mg, 1g.
Cis-(1S,2R)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid (CAS 185225-84-7) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: cis-(1S,2R)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid. InChIKey: XUWZMHVPMZXIRU-RCROYASPSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | cis-(1S,2R)-2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid |
| InChIKey | XUWZMHVPMZXIRU-RCROYASPSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1[C@@H]([C@@H]1F)N |
Computed by PubChem (NCBI)