Products 3023974-39-9
CAS 3023974-39-9 is the registry number for Florfenicol amine-d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(1R,2S)-2-amino-3-fluoro-1-[4-(trideuteriomethylsulfonyl)phenyl]propan-1-ol (CAS 3023974-39-9) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 250.31 g/mol. IUPAC name: (1R,2S)-2-amino-3-fluoro-1-[4-(trideuteriomethylsulfonyl)phenyl]propan-1-ol. InChIKey: XLSYLQDVLAXIKK-BFHKXKNSSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 250.31 g/mol |
| IUPAC name | (1R,2S)-2-amino-3-fluoro-1-[4-(trideuteriomethylsulfonyl)phenyl]propan-1-ol |
| InChIKey | XLSYLQDVLAXIKK-BFHKXKNSSA-N |
| SMILES | [2H]C([2H])([2H])S(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)N)O |
Computed by PubChem (NCBI)