CAS 417725-06-5 is the registry number for 2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid (CAS 417725-06-5) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: 2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid. InChIKey: XUWZMHVPMZXIRU-UHFFFAOYSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid |
| InChIKey | XUWZMHVPMZXIRU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1C(C1F)N |
Computed by PubChem (NCBI)