Products 417725-06-5

CAS 417725-06-5 is the registry number for 2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid (CAS 417725-06-5) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: 2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid. InChIKey: XUWZMHVPMZXIRU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14FNO3S
Molecular weight247.29 g/mol
IUPAC name2-fluorocyclopropan-1-amine;4-methylbenzenesulfonic acid
InChIKeyXUWZMHVPMZXIRU-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.C1C(C1F)N

Computed by PubChem (NCBI)