CAS 2008714-64-3 appears in our catalog under these names: Sitafloxacin Impurity 10, (1R,2R)-2-Fluorocyclopropanamine 4-methylbenzenesulfonate, 98% ,, 98% ,. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg.
4-methylbenzenesulfonic acid;trans-(1R,2R)-2-fluorocyclopropan-1-amine (CAS 2008714-64-3) is a chemical compound with the molecular formula C10H14FNO3S and a molecular weight of 247.29 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;trans-(1R,2R)-2-fluorocyclopropan-1-amine. InChIKey: XUWZMHVPMZXIRU-GEHKUQKJSA-N.
| Molecular formula | C10H14FNO3S |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;trans-(1R,2R)-2-fluorocyclopropan-1-amine |
| InChIKey | XUWZMHVPMZXIRU-GEHKUQKJSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1[C@H]([C@@H]1F)N |
Computed by PubChem (NCBI)