CAS 1217667-13-4 appears in our catalog under these names: (2R,3R)/(2S,3S)-Racemic fmoc-beta-hydroxy-phenylalanine, 95%, Fmoc-beta-hydroxy-Phe-OH (RR,SS). Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 1g, 250mg, 100mg.
(2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-phenylpropanoic acid (CAS 1217667-13-4) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-phenylpropanoic acid. InChIKey: UPEAXWJZGLFDFI-FGZHOGPDSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-phenylpropanoic acid |
| InChIKey | UPEAXWJZGLFDFI-FGZHOGPDSA-N |
| SMILES | C1=CC=C(C=C1)[C@H]([C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)