CAS 174879-27-7 appears in our catalog under these names: Fmoc-dl-o-tyrosine, 95%, Fmoc-DL-o-tyrosine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxyphenyl)propanoic acid (CAS 174879-27-7) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxyphenyl)propanoic acid. InChIKey: PQUQPFKXORWNNZ-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(2-hydroxyphenyl)propanoic acid |
| InChIKey | PQUQPFKXORWNNZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)