CAS 487060-72-0 appears in our catalog under these names: Fmoc-threo-beta-phenyl-Ser-OH, 96%, Fmoc-beta-hydroxy-Phe-OH (RS,SR), rel-(βS)-N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-β-hydroxy-D-phenylalanine, ≥95%, ≥95%. Offered by: Combi-blocks, Iris Biotech, Chemat. Available pack sizes: 5g, 1g, 250mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-phenylpropanoic acid (CAS 487060-72-0) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-phenylpropanoic acid. InChIKey: UPEAXWJZGLFDFI-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-phenylpropanoic acid |
| InChIKey | UPEAXWJZGLFDFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)O |
Computed by PubChem (NCBI)