CAS 882847-29-2 appears in our catalog under these names: 4-[2-(Fmoc-amino)ethoxy]-benzoic acid, 95%, 4-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethoxy)benzoic acid, 98%, 4-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)ethoxy)benzoic acid, 98%, 98%, 4-[2-({[(9h-fluoren-9-yl)methoxy]carbonyl}amino)ethoxy]benzoic acid, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 250mg, 50mg, 500mg, 2.5g.
4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]benzoic acid (CAS 882847-29-2) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]benzoic acid. InChIKey: OHVLIOLJNXNLPK-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]benzoic acid |
| InChIKey | OHVLIOLJNXNLPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCOC4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)