CAS 138775-49-2 appears in our catalog under these names: N-Fmoc-3-hydroxy-dl-phenylalanine, 95%, Fmoc-DL-meta-Tyrosine, 2-((((9h-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(3-hydroxyphenyl)propanoic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid (CAS 138775-49-2) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid. InChIKey: QTAKQPPYEQCJTJ-UHFFFAOYSA-N.
| Molecular formula | C24H21NO5 |
|---|---|
| Molecular weight | 403.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-hydroxyphenyl)propanoic acid |
| InChIKey | QTAKQPPYEQCJTJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC(=CC=C4)O)C(=O)O |
Computed by PubChem (NCBI)