Products 82874-83-7

CAS 82874-83-7 is the registry number for (Trityloxyimino)malonic acid dimethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Dimethyl 2-trityloxyiminopropanedioate (CAS 82874-83-7) is a chemical compound with the molecular formula C24H21NO5 and a molecular weight of 403.4 g/mol. IUPAC name: dimethyl 2-trityloxyiminopropanedioate. InChIKey: RQPRQESULBQBMV-UHFFFAOYSA-N.

Identity
Molecular formulaC24H21NO5
Molecular weight403.4 g/mol
IUPAC namedimethyl 2-trityloxyiminopropanedioate
InChIKeyRQPRQESULBQBMV-UHFFFAOYSA-N
SMILESCOC(=O)C(=NOC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)OC

Computed by PubChem (NCBI)