Products 1217746-03-6
CAS 1217746-03-6 appears in our catalog under these names: Lamivudine-15N2,13C, >95% (HPLC), Lamivudine-15N2,13C, ≥95 atom%,≥96%, ≥95 atom%,≥96%, Lamivudine-15N2,13C. Offered by: TRC, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 5 mg.
4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one (CAS 1217746-03-6) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 232.24 g/mol. IUPAC name: 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one. InChIKey: JTEGQNOMFQHVDC-PIAXYVKQSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 232.24 g/mol |
| IUPAC name | 4-amino-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one |
| InChIKey | JTEGQNOMFQHVDC-PIAXYVKQSA-N |
| SMILES | C1[C@H](O[C@H](S1)CO)[15N]2C=CC(=[15N][13C]2=O)N |
Computed by PubChem (NCBI)