CAS 131086-22-1 appears in our catalog under these names: Lamivudine EP Impurity B, Lamivudine, (+/-)-trans-, (+/-)-trans-Lamivudine, LAMIVUDINE-TRANS, (±)-trans-Lamivudine. Offered by: Chemat Brand, TargetMol, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 100mg, 1mg, Get quote.
4-amino-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 131086-22-1) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 4-amino-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: JTEGQNOMFQHVDC-BQBZGAKWSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-amino-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | JTEGQNOMFQHVDC-BQBZGAKWSA-N |
| SMILES | C1[C@H](O[C@@H](S1)CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)