CAS 136846-20-3 appears in our catalog under these names: 4-Amino-1-((2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidin-2(1H)-one, 97%, Lamivudine EP Impurity B, Lamivudine Impurity 1, Lamivudine EP Impurity B ((2S,5S)-Isomer), Lamivudine Impurity 12. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,25mg, 1mg.
4-amino-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 136846-20-3) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 4-amino-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: JTEGQNOMFQHVDC-BQBZGAKWSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-amino-1-[(2S,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | JTEGQNOMFQHVDC-BQBZGAKWSA-N |
| SMILES | C1[C@H](O[C@@H](S1)CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)