CAS 139757-68-9 appears in our catalog under these names: 5'-epi Lamivudine, 4’-Epi Lamivudine, >95% (HPLC). Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 2mg, 1mg, 5mg.
4-amino-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 139757-68-9) is a chemical compound with the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. IUPAC name: 4-amino-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: JTEGQNOMFQHVDC-RNFRBKRXSA-N.
| Molecular formula | C8H11N3O3S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-amino-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | JTEGQNOMFQHVDC-RNFRBKRXSA-N |
| SMILES | C1[C@@H](O[C@H](S1)CO)N2C=CC(=NC2=O)N |
Computed by PubChem (NCBI)