Products 1217863-27-8
CAS 1217863-27-8 is the registry number for 5-Methyl-4-phenyl-2-(2-pyridyl)thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-methyl-4-phenyl-2-pyridin-2-yl-1,3-thiazole (CAS 1217863-27-8) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: 5-methyl-4-phenyl-2-pyridin-2-yl-1,3-thiazole. InChIKey: ZTYJKDZBAFCCRT-UHFFFAOYSA-N.
| Molecular formula | C15H12N2S |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 5-methyl-4-phenyl-2-pyridin-2-yl-1,3-thiazole |
| InChIKey | ZTYJKDZBAFCCRT-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(S1)C2=CC=CC=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)