CAS 6318-74-7 appears in our catalog under these names: 4,5-Diphenylthiazol-2-amine 97%, 4,5-diphenyl-1,3-thiazol-2-amine, 98%. Offered by: Ambeed, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 2.5g.
4,5-diphenyl-1,3-thiazol-2-amine (CAS 6318-74-7) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: 4,5-diphenyl-1,3-thiazol-2-amine. InChIKey: XDWGEGZDMFHZBL-UHFFFAOYSA-N.
| Molecular formula | C15H12N2S |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 4,5-diphenyl-1,3-thiazol-2-amine |
| InChIKey | XDWGEGZDMFHZBL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC(=N2)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)