CAS 885051-07-0 appears in our catalog under these names: (+)–Benzotetramisole, (+)-Benzotetramisole, >97.0%(GC), (R)-2-Phenyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole 98% 99%ee, (R)-2-Phenyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole, 97%, 97%, (R)-2-Phenyl-2,3-dihydrobenzo[d]imidazo[2,1-b]thiazole, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 200mg, 100mg.
(2R)-2-phenyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole (CAS 885051-07-0) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: (2R)-2-phenyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole. InChIKey: YGCWPCVAVSIFLO-LBPRGKRZSA-N.
| Molecular formula | C15H12N2S |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | (2R)-2-phenyl-1,2-dihydroimidazo[2,1-b][1,3]benzothiazole |
| InChIKey | YGCWPCVAVSIFLO-LBPRGKRZSA-N |
| SMILES | C1[C@H](N=C2N1C3=CC=CC=C3S2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)