Products 136802-77-2

CAS 136802-77-2 is the registry number for 1,5-Diphenyl-1h-imidazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.

Structural formula: {0} (CAS {1})

3,4-diphenyl-1H-imidazole-2-thione (CAS 136802-77-2) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: 3,4-diphenyl-1H-imidazole-2-thione. InChIKey: WVWPIDMVMOHYEG-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12N2S
Molecular weight252.3 g/mol
IUPAC name3,4-diphenyl-1H-imidazole-2-thione
InChIKeyWVWPIDMVMOHYEG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CNC(=S)N2C3=CC=CC=C3

Computed by PubChem (NCBI)