CAS 136802-77-2 is the registry number for 1,5-Diphenyl-1h-imidazole-2-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g, 25g.
3,4-diphenyl-1H-imidazole-2-thione (CAS 136802-77-2) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: 3,4-diphenyl-1H-imidazole-2-thione. InChIKey: WVWPIDMVMOHYEG-UHFFFAOYSA-N.
| Molecular formula | C15H12N2S |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 3,4-diphenyl-1H-imidazole-2-thione |
| InChIKey | WVWPIDMVMOHYEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)