CAS 25021-48-1 is the registry number for 4-(2-Phenylthiazol-4-yl)aniline, 97%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
4-(2-phenyl-1,3-thiazol-4-yl)aniline (CAS 25021-48-1) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: 4-(2-phenyl-1,3-thiazol-4-yl)aniline. InChIKey: IOPGDXLYFPHBLA-UHFFFAOYSA-N.
| Molecular formula | C15H12N2S |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 4-(2-phenyl-1,3-thiazol-4-yl)aniline |
| InChIKey | IOPGDXLYFPHBLA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)