CAS 96303-85-4 is the registry number for 2-(5-Phenylthiazol-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(5-phenyl-1,3-thiazol-2-yl)aniline (CAS 96303-85-4) is a chemical compound with the molecular formula C15H12N2S and a molecular weight of 252.3 g/mol. IUPAC name: 2-(5-phenyl-1,3-thiazol-2-yl)aniline. InChIKey: AXQBGEONWKVZOS-UHFFFAOYSA-N.
| Molecular formula | C15H12N2S |
|---|---|
| Molecular weight | 252.3 g/mol |
| IUPAC name | 2-(5-phenyl-1,3-thiazol-2-yl)aniline |
| InChIKey | AXQBGEONWKVZOS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(S2)C3=CC=CC=C3N |
Computed by PubChem (NCBI)