Products 1956321-27-9
CAS 1956321-27-9 appears in our catalog under these names: tert-Butyl 4,6-dichloronicotinate, 95%, TERT-BUTYL 4,6-DICHLORONICOTINATE, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 10g, 5g, 25g, 250mg.
Tert-butyl 4,6-dichloropyridine-3-carboxylate (CAS 1956321-27-9) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: tert-butyl 4,6-dichloropyridine-3-carboxylate. InChIKey: XPAVOQSQZMCRRR-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | tert-butyl 4,6-dichloropyridine-3-carboxylate |
| InChIKey | XPAVOQSQZMCRRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1Cl)Cl |
Computed by PubChem (NCBI)