CAS 1218369-88-0 is the registry number for 2-Amino-1-(1,1-dioxidothiomorpholino)propan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-amino-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one (CAS 1218369-88-0) is a chemical compound with the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. IUPAC name: 2-amino-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one. InChIKey: GEYMYRRKAWOGSJ-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O3S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 2-amino-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one |
| InChIKey | GEYMYRRKAWOGSJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCS(=O)(=O)CC1)N |
Computed by PubChem (NCBI)