Products 2884551-41-9
CAS 2884551-41-9 is the registry number for 1-((3-Hydroxyazetidin-1-yl)methyl)cyclopropane-1-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3-hydroxyazetidin-1-yl)methyl]cyclopropane-1-sulfonamide (CAS 2884551-41-9) is a chemical compound with the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. IUPAC name: 1-[(3-hydroxyazetidin-1-yl)methyl]cyclopropane-1-sulfonamide. InChIKey: KYZSZWFKEOXQQB-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O3S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 1-[(3-hydroxyazetidin-1-yl)methyl]cyclopropane-1-sulfonamide |
| InChIKey | KYZSZWFKEOXQQB-UHFFFAOYSA-N |
| SMILES | C1CC1(CN2CC(C2)O)S(=O)(=O)N |
Computed by PubChem (NCBI)