CAS 1422140-49-5 is the registry number for 3-(Methylsulfonyl)-9-oxa-3,7-diazabicyclo[3.3.1]nonane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methylsulfonyl-9-oxa-3,7-diazabicyclo[3.3.1]nonane (CAS 1422140-49-5) is a chemical compound with the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. IUPAC name: 3-methylsulfonyl-9-oxa-3,7-diazabicyclo[3.3.1]nonane. InChIKey: IZOUUDSXVATWOB-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O3S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 3-methylsulfonyl-9-oxa-3,7-diazabicyclo[3.3.1]nonane |
| InChIKey | IZOUUDSXVATWOB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CC2CNCC(C1)O2 |
Computed by PubChem (NCBI)