Products 2656418-05-0
CAS 2656418-05-0 is the registry number for rel-(4AR,7aS)-6-(methylsulfonyl)octahydropyrrolo[3,4-b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,7aS)-6-methylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine (CAS 2656418-05-0) is a chemical compound with the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. IUPAC name: (4aR,7aS)-6-methylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine. InChIKey: MOULABBNGOAKAM-RQJHMYQMSA-N.
| Molecular formula | C7H14N2O3S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | (4aR,7aS)-6-methylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b][1,4]oxazine |
| InChIKey | MOULABBNGOAKAM-RQJHMYQMSA-N |
| SMILES | CS(=O)(=O)N1C[C@@H]2[C@H](C1)OCCN2 |
Computed by PubChem (NCBI)