CAS 301860-85-5 is the registry number for 3-(1,1-Dioxidotetrahydrothiophen-3-yl)-1,1-dimethylurea, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea (CAS 301860-85-5) is a chemical compound with the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. IUPAC name: 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea. InChIKey: CXNLWMNGJLNXLS-UHFFFAOYSA-N.
| Molecular formula | C7H14N2O3S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 3-(1,1-dioxothiolan-3-yl)-1,1-dimethylurea |
| InChIKey | CXNLWMNGJLNXLS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1CCS(=O)(=O)C1 |
Computed by PubChem (NCBI)