CAS 2322943-52-0 is the registry number for (S)-3-Amino-N-(1,1-dioxidotetrahydrothiophen-3-yl)propanamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide (CAS 2322943-52-0) is a chemical compound with the molecular formula C7H14N2O3S and a molecular weight of 206.27 g/mol. IUPAC name: 3-amino-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide. InChIKey: MUISNVNUYNBDOK-LURJTMIESA-N.
| Molecular formula | C7H14N2O3S |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 3-amino-N-[(3S)-1,1-dioxothiolan-3-yl]propanamide |
| InChIKey | MUISNVNUYNBDOK-LURJTMIESA-N |
| SMILES | C1CS(=O)(=O)C[C@H]1NC(=O)CCN |
Computed by PubChem (NCBI)