Products 1218741-14-0
CAS 1218741-14-0 is the registry number for 2-(2,3-Dichlorophenyl)-2-(methylamino)acetic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(2,3-dichlorophenyl)-2-(methylamino)acetic acid (CAS 1218741-14-0) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 2-(2,3-dichlorophenyl)-2-(methylamino)acetic acid. InChIKey: XUSJFRAYQKFOSU-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 2-(2,3-dichlorophenyl)-2-(methylamino)acetic acid |
| InChIKey | XUSJFRAYQKFOSU-UHFFFAOYSA-N |
| SMILES | CNC(C1=C(C(=CC=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)