Products 1218951-00-8
CAS 1218951-00-8 is the registry number for Methyl 2-(3-chlorophenyl)-2-cyanoacetate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-(3-chlorophenyl)-2-cyanoacetate (CAS 1218951-00-8) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: methyl 2-(3-chlorophenyl)-2-cyanoacetate. InChIKey: GCMXNRWGEQVNFC-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | methyl 2-(3-chlorophenyl)-2-cyanoacetate |
| InChIKey | GCMXNRWGEQVNFC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C#N)C1=CC(=CC=C1)Cl |
Computed by PubChem (NCBI)