CAS 1219080-58-6 appears in our catalog under these names: Isoquinolin-1-ylboronic acid, 1-Isoquinolineboronic acid, 95%. Offered by: TRC, AmBeed. Available pack sizes: 250mg, 1g.
Isoquinolin-1-ylboronic acid (CAS 1219080-58-6) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: isoquinolin-1-ylboronic acid. InChIKey: RVUIQFODKHOTHQ-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | isoquinolin-1-ylboronic acid |
| InChIKey | RVUIQFODKHOTHQ-UHFFFAOYSA-N |
| SMILES | B(C1=NC=CC2=CC=CC=C12)(O)O |
Computed by PubChem (NCBI)