Products 121917-57-5
CAS 121917-57-5 appears in our catalog under these names: (-)-MK 801 Maleate, (-)-Dizocilpine maleate/ 99.89% (existing batch purity), (–)–MK 801, (−)-MK-801 (maleate), 98%, 98%, (-)-Dizocilpine (maleate), 99.92%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 100 mg, 10mM/1mL, 5 mg.
(Z)-but-2-enedioic acid;(1R,9S)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene (CAS 121917-57-5) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (Z)-but-2-enedioic acid;(1R,9S)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene. InChIKey: QLTXKCWMEZIHBJ-FWHYOZOBSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;(1R,9S)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaene |
| InChIKey | QLTXKCWMEZIHBJ-FWHYOZOBSA-N |
| SMILES | C[C@]12C3=CC=CC=C3C[C@H](N1)C4=CC=CC=C24.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Dizocilpine maleate, (-)-, (-)-MK 801 Maleate, (-)-MK 801 hydrogen maleate, (-)-dizocilpine maleate, (5R,10S)-5-methyl-10,11-dihydro-5H-5,10-epiminodibenzo[a,d][7]annulene maleate, (-)-Dizocilpine (Maleate), (-)-MK 801 Maleate; (-)-MK 801, (+)-MK 801 Maleate, (-)MK-801 maleate?, ()-MK-801 hydrogen maleate