CAS 32690-93-0 appears in our catalog under these names: 2,4,4',5-Tetrachlorobiphenyl, >95% (HPLC), PCB No. 74 10 µg/mL in Isooctane, 2,4,4',5–Tetrachlorobiphenyl, PCB 74, ROTI®Star, 10 mg, glass. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Roth. Available pack sizes: 100mg, 250mg, 25mg, 10ml, 1ml, 10mg.
1,2,4-trichloro-5-(4-chlorophenyl)benzene (CAS 32690-93-0) is a chemical compound with the molecular formula C12H6Cl4 and a molecular weight of 292.0 g/mol. IUPAC name: 1,2,4-trichloro-5-(4-chlorophenyl)benzene. InChIKey: TULCXSBAPHCWCF-UHFFFAOYSA-N.
| Molecular formula | C12H6Cl4 |
|---|---|
| Molecular weight | 292.0 g/mol |
| IUPAC name | 1,2,4-trichloro-5-(4-chlorophenyl)benzene |
| InChIKey | TULCXSBAPHCWCF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)