CAS 1219795-43-3 appears in our catalog under these names: N–(3–Phenylpropionyl)glycine–d2, N-(3-Phenylpropionyl)glycine-d2, 99.64%, N-(3-Phenylpropionyl)glycine-2,2-d2, 98 atom % D, min 98% Chemical Purity. Offered by: GLPBio, MedChemExpress, CDN. Available pack sizes: 1mg, 5 mg, 1 mg, 0,05g, 0,01g.
2,2-dideuterio-2-(3-phenylpropanoylamino)acetic acid (CAS 1219795-43-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 209.24 g/mol. IUPAC name: 2,2-dideuterio-2-(3-phenylpropanoylamino)acetic acid. InChIKey: YEIQSAXUPKPPBN-MGVXTIMCSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | 2,2-dideuterio-2-(3-phenylpropanoylamino)acetic acid |
| InChIKey | YEIQSAXUPKPPBN-MGVXTIMCSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)CCC1=CC=CC=C1 |
Computed by PubChem (NCBI)