CAS 1219798-50-1 appears in our catalog under these names: iso-Propylamine-d9 DCl, 98 atom % D, min 98% Chemical Purity, Propan-2-amine-d9 (hydrochloride), 99%. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 50 mg, 25 mg, 100 mg.
(2H)chlorane;N,N,1,1,1,2,3,3,3-nonadeuteriopropan-2-amine (CAS 1219798-50-1) is a chemical compound with the molecular formula C3H10ClN and a molecular weight of 105.63 g/mol. IUPAC name: (2H)chlorane;N,N,1,1,1,2,3,3,3-nonadeuteriopropan-2-amine. InChIKey: ISYORFGKSZLPNW-JYRZJXIGSA-N.
| Molecular formula | C3H10ClN |
|---|---|
| Molecular weight | 105.63 g/mol |
| IUPAC name | (2H)chlorane;N,N,1,1,1,2,3,3,3-nonadeuteriopropan-2-amine |
| InChIKey | ISYORFGKSZLPNW-JYRZJXIGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])N([2H])[2H].[2H]Cl |
Computed by PubChem (NCBI)