CAS 344298-88-0 appears in our catalog under these names: n-Propyl-d7-amine HCl, 98 atom % D, min 98% Chemical Purity, n-Propyl-amine-d7 (Hydrochloride). Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1,1,2,2,3,3,3-heptadeuteriopropan-1-amine;hydrochloride (CAS 344298-88-0) is a chemical compound with the molecular formula C3H10ClN and a molecular weight of 102.61 g/mol. IUPAC name: 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine;hydrochloride. InChIKey: PYNUOAIJIQGACY-DEPOAORMSA-N.
| Molecular formula | C3H10ClN |
|---|---|
| Molecular weight | 102.61 g/mol |
| IUPAC name | 1,1,2,2,3,3,3-heptadeuteriopropan-1-amine;hydrochloride |
| InChIKey | PYNUOAIJIQGACY-DEPOAORMSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])N.Cl |
Computed by PubChem (NCBI)