Products 347840-14-6
CAS 347840-14-6 appears in our catalog under these names: Trimethyl-d6-amine HCl (dimethyl-d6), 99 atom % D, min 98% Chemical Purity, Trimethylammonium chloride–d6, Trimethylammonium chloride-d6, 99.35%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 5mg, 5 mg, 10 mg.
1,1,1-trideuterio-N-methyl-N-(trideuteriomethyl)methanamine;hydrochloride (CAS 347840-14-6) is a chemical compound with the molecular formula C3H10ClN and a molecular weight of 101.61 g/mol. IUPAC name: 1,1,1-trideuterio-N-methyl-N-(trideuteriomethyl)methanamine;hydrochloride. InChIKey: SZYJELPVAFJOGJ-TXHXQZCNSA-N.
| Molecular formula | C3H10ClN |
|---|---|
| Molecular weight | 101.61 g/mol |
| IUPAC name | 1,1,1-trideuterio-N-methyl-N-(trideuteriomethyl)methanamine;hydrochloride |
| InChIKey | SZYJELPVAFJOGJ-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])N(C)C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)