Products 126794-59-0
CAS 126794-59-0 appears in our catalog under these names: iso-Propyl-1,1,1,3,3,3-d6-amine HCl, 99 atom % D, min 98% Chemical Purity, Propan–2–amine–d6 hydrochloride, Propan-2-amine-d6 (hydrochloride), 98.43%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 25mg, 5mg, 50mg, 100 mg, 10 mg.
1,1,1,3,3,3-hexadeuteriopropan-2-amine;hydrochloride (CAS 126794-59-0) is a chemical compound with the molecular formula C3H10ClN and a molecular weight of 101.61 g/mol. IUPAC name: 1,1,1,3,3,3-hexadeuteriopropan-2-amine;hydrochloride. InChIKey: ISYORFGKSZLPNW-TXHXQZCNSA-N.
| Molecular formula | C3H10ClN |
|---|---|
| Molecular weight | 101.61 g/mol |
| IUPAC name | 1,1,1,3,3,3-hexadeuteriopropan-2-amine;hydrochloride |
| InChIKey | ISYORFGKSZLPNW-TXHXQZCNSA-N |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])N.Cl |
Computed by PubChem (NCBI)