Products 1398065-66-1
CAS 1398065-66-1 appears in our catalog under these names: Propan-1-amine-d5 hydrochloride, n-Propyl-2,2,3,3,3-d5-amine HCl, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,25g, 0,1g.
2,2,3,3,3-pentadeuteriopropan-1-amine;hydrochloride (CAS 1398065-66-1) is a chemical compound with the molecular formula C3H10ClN and a molecular weight of 100.60 g/mol. IUPAC name: 2,2,3,3,3-pentadeuteriopropan-1-amine;hydrochloride. InChIKey: PYNUOAIJIQGACY-LUIAAVAXSA-N.
| Molecular formula | C3H10ClN |
|---|---|
| Molecular weight | 100.60 g/mol |
| IUPAC name | 2,2,3,3,3-pentadeuteriopropan-1-amine;hydrochloride |
| InChIKey | PYNUOAIJIQGACY-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CN.Cl |
Computed by PubChem (NCBI)