CAS 1219804-28-0 appears in our catalog under these names: 2,6-Dichlorobenzamide-3,4,5-d3, >95% (HPLC), 2,6-Dichlorobenzamide-3,4,5-d3, 98 atom % D, min 98% Chemical Purity, 2,6-Dichlorobenzamide-3,4,5-d3, 99.9%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g, 25 mg, 10 mg, 50 mg.
2,6-dichloro-3,4,5-trideuteriobenzamide (CAS 1219804-28-0) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 193.04 g/mol. IUPAC name: 2,6-dichloro-3,4,5-trideuteriobenzamide. InChIKey: JHSPCUHPSIUQRB-CBYSEHNBSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 193.04 g/mol |
| IUPAC name | 2,6-dichloro-3,4,5-trideuteriobenzamide |
| InChIKey | JHSPCUHPSIUQRB-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])Cl)C(=O)N)Cl)[2H] |
Computed by PubChem (NCBI)