CAS 2741330-83-4 is the registry number for 2,6-Dichlorobenzamide-13C6. Offered by: TRC. Available pack sizes: 25mg.
2,6-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxamide (CAS 2741330-83-4) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 195.98 g/mol. IUPAC name: 2,6-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxamide. InChIKey: JHSPCUHPSIUQRB-IDEBNGHGSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 195.98 g/mol |
| IUPAC name | 2,6-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxamide |
| InChIKey | JHSPCUHPSIUQRB-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13C](=[13CH]1)Cl)C(=O)N)Cl |
Computed by PubChem (NCBI)